C19H16N2 — CID 11288762
3,11,12,14-tetrahydroyohimban (PubChem CID 11288762) has the molecular formula C19H16N2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3,11,12,14-tetrahydroyohimban.
| Compound Name | 3,11,12,14-tetrahydroyohimban |
|---|---|
| PubChem CID | 11288762 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3,11,12,14-tetrahydroyohimban |
| SMILES | C1=C2c3[nH]c4ccccc4c3CCN2Cc2ccccc21 |
| InChI | InChI=1S/C19H16N2/c1-2-6-14-12-21-10-9-16-15-7-3-4-8-17(15)20-19(16)18(21)11-13(14)5-1/h1-8,11,20H,9-10,12H2 |
| InChIKey | SPGPSBAAKACJFV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |