C14H12N2O4 — CID 90862980
2,6-dihydro-1H-azepino[4,5-b]indole-3,5-dicarboxylic acid (PubChem CID 90862980) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2,6-dihydro-1H-azepino[4,5-b]indole-3,5-dicarboxylic acid.
| Compound Name | 2,6-dihydro-1H-azepino[4,5-b]indole-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 90862980 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2,6-dihydro-1H-azepino[4,5-b]indole-3,5-dicarboxylic acid |
| SMILES | O=C(O)C1=CN(C(=O)O)CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C14H12N2O4/c17-13(18)10-7-16(14(19)20)6-5-9-8-3-1-2-4-11(8)15-12(9)10/h1-4,7,15H,5-6H2,(H,17,18)(H,19,20) |
| InChIKey | JERSMUDQNJHKDP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |