C17H12ClN3 — CID 136693641
4-chloro-9,10,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2,4,6,8,14,16,18-octaene (PubChem CID 136693641) has the molecular formula C17H12ClN3 and a molecular weight of 293.76 g/mol. Its IUPAC name is 4-chloro-9,10,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2,4,6,8,14,16,18-octaene.
| Compound Name | 4-chloro-9,10,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2,4,6,8,14,16,18-octaene |
|---|---|
| PubChem CID | 136693641 |
| Molecular Formula | C17H12ClN3 |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-chloro-9,10,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2,4,6,8,14,16,18-octaene |
| SMILES | Clc1cccc2nn3c(c12)-c1[nH]c2ccccc2c1CC3 |
| InChI | InChI=1S/C17H12ClN3/c18-12-5-3-7-14-15(12)17-16-11(8-9-21(17)20-14)10-4-1-2-6-13(10)19-16/h1-7,19H,8-9H2 |
| InChIKey | OSHWWYGRJZGNLU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|