C16H18N2 — CID 70535428
1-ethyl-3,5,6,11-tetrahydro-2H-indolizino[8,7-b]indole (PubChem CID 70535428) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-ethyl-3,5,6,11-tetrahydro-2H-indolizino[8,7-b]indole.
| Compound Name | 1-ethyl-3,5,6,11-tetrahydro-2H-indolizino[8,7-b]indole |
|---|---|
| PubChem CID | 70535428 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-ethyl-3,5,6,11-tetrahydro-2H-indolizino[8,7-b]indole |
| SMILES | CCC1=C2c3[nH]c4ccccc4c3CCN2CC1 |
| InChI | InChI=1S/C16H18N2/c1-2-11-7-9-18-10-8-13-12-5-3-4-6-14(12)17-15(13)16(11)18/h3-6,17H,2,7-10H2,1H3 |
| InChIKey | AYNJVDLLJBJNGY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |