C23H21N3O3 — CID 13278045
1-ethyl-3-(4-nitrophenyl)-3,6,7,12-tetrahydro-2H-indolo[2,3-a]quinolizin-4-one (PubChem CID 13278045) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-ethyl-3-(4-nitrophenyl)-3,6,7,12-tetrahydro-2H-indolo[2,3-a]quinolizin-4-one.
| Compound Name | 1-ethyl-3-(4-nitrophenyl)-3,6,7,12-tetrahydro-2H-indolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 13278045 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-ethyl-3-(4-nitrophenyl)-3,6,7,12-tetrahydro-2H-indolo[2,3-a]quinolizin-4-one |
| SMILES | CCC1=C2c3[nH]c4ccccc4c3CCN2C(=O)C(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C23H21N3O3/c1-2-14-13-19(15-7-9-16(10-8-15)26(28)29)23(27)25-12-11-18-17-5-3-4-6-20(17)24-21(18)22(14)25/h3-10,19,24H,2,11-13H2,1H3 |
| InChIKey | GWGQTXIUQYYORT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|