C19H18N2O2 — CID 102286615
(18R)-18-methyl-19-oxa-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-1(21),2(10),4,6,8,16-hexaen-20-one (PubChem CID 102286615) has the molecular formula C19H18N2O2 and a molecular weight of 306.36 g/mol. Its IUPAC name is (18R)-18-methyl-19-oxa-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-1(21),2(10),4,6,8,16-hexaen-20-one.
| Compound Name | (18R)-18-methyl-19-oxa-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-1(21),2(10),4,6,8,16-hexaen-20-one |
|---|---|
| PubChem CID | 102286615 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (18R)-18-methyl-19-oxa-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-1(21),2(10),4,6,8,16-hexaen-20-one |
| SMILES | C[C@H]1OC(=O)C2=C3C1=CCCN3CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18N2O2/c1-11-12-6-4-9-21-10-8-14-13-5-2-3-7-15(13)20-17(14)16(18(12)21)19(22)23-11/h2-3,5-7,11,20H,4,8-10H2,1H3/t11-/m1/s1 |
| InChIKey | JMWYXPRJNQMRFW-LLVKDONJSA-N |
| XLogP | 3.01 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |