C17H20N2O3 — CID 10902661
(2S,4S)-4-(1-hydroxy-2-methylpropan-2-yl)-3-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-5-one (PubChem CID 10902661) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2S,4S)-4-(1-hydroxy-2-methylpropan-2-yl)-3-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-5-one.
| Compound Name | (2S,4S)-4-(1-hydroxy-2-methylpropan-2-yl)-3-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-5-one |
|---|---|
| PubChem CID | 10902661 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2S,4S)-4-(1-hydroxy-2-methylpropan-2-yl)-3-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-5-one |
| SMILES | CC(C)(CO)[C@@H]1O[C@H]2c3[nH]c4ccccc4c3CCN2C1=O |
| InChI | InChI=1S/C17H20N2O3/c1-17(2,9-20)14-15(21)19-8-7-11-10-5-3-4-6-12(10)18-13(11)16(19)22-14/h3-6,14,16,18,20H,7-9H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | YWFKMNOXOXFOME-ZBFHGGJFSA-N |
| XLogP | 1.97 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|