C18H18N2O — CID 92754297
(2S,3R,8R)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),5,14,16,18-pentaen-9-one (PubChem CID 92754297) has the molecular formula C18H18N2O and a molecular weight of 278.35 g/mol. Its IUPAC name is (2S,3R,8R)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),5,14,16,18-pentaen-9-one.
| Compound Name | (2S,3R,8R)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),5,14,16,18-pentaen-9-one |
|---|---|
| PubChem CID | 92754297 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2S,3R,8R)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),5,14,16,18-pentaen-9-one |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2[C@H]2c3[nH]c4ccccc4c3CCN12 |
| InChI | InChI=1S/C18H18N2O/c21-18-14-7-2-1-6-13(14)17-16-12(9-10-20(17)18)11-5-3-4-8-15(11)19-16/h1-5,8,13-14,17,19H,6-7,9-10H2/t13-,14-,17+/m1/s1 |
| InChIKey | ZEESYDPKTRQKSC-CPUCHLNUSA-N |
| XLogP | 3.19 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|