C19H20N2O — CID 928785
(2S,3S,8R)-5-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),5,14,16,18-pentaen-9-one (PubChem CID 928785) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S,3S,8R)-5-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),5,14,16,18-pentaen-9-one.
| Compound Name | (2S,3S,8R)-5-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),5,14,16,18-pentaen-9-one |
|---|---|
| PubChem CID | 928785 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2S,3S,8R)-5-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),5,14,16,18-pentaen-9-one |
| SMILES | CC1=CC[C@H]2C(=O)N3CCc4c([nH]c5ccccc45)[C@@H]3[C@H]2C1 |
| InChI | InChI=1S/C19H20N2O/c1-11-6-7-14-15(10-11)18-17-13(8-9-21(18)19(14)22)12-4-2-3-5-16(12)20-17/h2-6,14-15,18,20H,7-10H2,1H3/t14-,15+,18+/m1/s1 |
| InChIKey | WWIMATJEWPNNPT-VKJFTORMSA-N |
| XLogP | 3.58 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|