C22H22N2O3S — CID 11429334
1-(4-methylphenyl)sulfonyl-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one (PubChem CID 11429334) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 11429334 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)C2CCC(=O)N3CCc4c([nH]c5ccccc45)C23)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c1-14-6-8-15(9-7-14)28(26,27)19-10-11-20(25)24-13-12-17-16-4-2-3-5-18(16)23-21(17)22(19)24/h2-9,19,22-23H,10-13H2,1H3 |
| InChIKey | KHAZCIFTPCODPG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|