C15H16N2O — CID 139258691
(11bR)-9-methyl-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indol-3-one (PubChem CID 139258691) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is (11bR)-9-methyl-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indol-3-one.
| Compound Name | (11bR)-9-methyl-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indol-3-one |
|---|---|
| PubChem CID | 139258691 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (11bR)-9-methyl-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indol-3-one |
| SMILES | Cc1ccc2c3c([nH]c2c1)[C@H]1CCC(=O)N1CC3 |
| InChI | InChI=1S/C15H16N2O/c1-9-2-3-10-11-6-7-17-13(4-5-14(17)18)15(11)16-12(10)8-9/h2-3,8,13,16H,4-7H2,1H3/t13-/m1/s1 |
| InChIKey | WAIWCJDQJBSRRZ-CYBMUJFWSA-N |
| XLogP | 2.70 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|