C17H20N2O — CID 1403540
(2R,5S)-5-methyl-7,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),12,14,16-tetraen-6-one (PubChem CID 1403540) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (2R,5S)-5-methyl-7,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),12,14,16-tetraen-6-one.
| Compound Name | (2R,5S)-5-methyl-7,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),12,14,16-tetraen-6-one |
|---|---|
| PubChem CID | 1403540 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (2R,5S)-5-methyl-7,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),12,14,16-tetraen-6-one |
| SMILES | C[C@H]1CC[C@@H]2c3[nH]c4ccccc4c3CCCN2C1=O |
| InChI | InChI=1S/C17H20N2O/c1-11-8-9-15-16-13(6-4-10-19(15)17(11)20)12-5-2-3-7-14(12)18-16/h2-3,5,7,11,15,18H,4,6,8-10H2,1H3/t11-,15+/m0/s1 |
| InChIKey | ZTDIABHGDNWMCF-XHDPSFHLSA-N |
| XLogP | 3.41 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|