C17H22N2O — CID 142977493
ethane;2-methyl-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indol-3-one (PubChem CID 142977493) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is ethane;2-methyl-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indol-3-one.
| Compound Name | ethane;2-methyl-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indol-3-one |
|---|---|
| PubChem CID | 142977493 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | ethane;2-methyl-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indol-3-one |
| SMILES | CC.CC1CC2c3[nH]c4ccccc4c3CCN2C1=O |
| InChI | InChI=1S/C15H16N2O.C2H6/c1-9-8-13-14-11(6-7-17(13)15(9)18)10-4-2-3-5-12(10)16-14;1-2/h2-5,9,13,16H,6-8H2,1H3;1-2H3 |
| InChIKey | WETLQMJNMITWNJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|