C15H20N2 — CID 170405728
3,4,8-trimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole (PubChem CID 170405728) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3,4,8-trimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole.
| Compound Name | 3,4,8-trimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 170405728 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3,4,8-trimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
| SMILES | Cc1ccc2c3c([nH]c2c1)CC(C)N(C)CC3 |
| InChI | InChI=1S/C15H20N2/c1-10-4-5-12-13-6-7-17(3)11(2)9-15(13)16-14(12)8-10/h4-5,8,11,16H,6-7,9H2,1-3H3 |
| InChIKey | XPTAHVKXYXXNTO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|