C15H20N2O — CID 168957107
(2R)-9-methoxy-2,3-dimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole (PubChem CID 168957107) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (2R)-9-methoxy-2,3-dimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole.
| Compound Name | (2R)-9-methoxy-2,3-dimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 168957107 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2R)-9-methoxy-2,3-dimethyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)C[C@@H](C)N(C)CC3 |
| InChI | InChI=1S/C15H20N2O/c1-10-8-12-13-9-11(18-3)4-5-14(13)16-15(12)6-7-17(10)2/h4-5,9-10,16H,6-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | LRRIPIBAQGPQFV-SNVBAGLBSA-N |
| XLogP | 2.60 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|