C19H25N3O2 — CID 91352168
2-[(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]-1-pyrrolidin-1-ylethanone (PubChem CID 91352168) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 91352168 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2-[(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]-1-pyrrolidin-1-ylethanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC(NCC(=O)N1CCCC1)CC3 |
| InChI | InChI=1S/C19H25N3O2/c1-24-14-5-7-18-16(11-14)15-10-13(4-6-17(15)21-18)20-12-19(23)22-8-2-3-9-22/h5,7,11,13,20-21H,2-4,6,8-10,12H2,1H3 |
| InChIKey | FAIYUDHLTFFQEQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|