C18H24N2O2 — CID 113203990
N-tert-butyl-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203990) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-tert-butyl-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-tert-butyl-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203990 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-tert-butyl-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC(C(=O)NC(C)(C)C)CC3 |
| InChI | InChI=1S/C18H24N2O2/c1-18(2,3)20-17(21)11-5-7-15-13(9-11)14-10-12(22-4)6-8-16(14)19-15/h6,8,10-11,19H,5,7,9H2,1-4H3,(H,20,21) |
| InChIKey | RAWCKEUIWANYMN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|