C32H35N7 — CID 25003992
1-[(3R)-2,7-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]-N,N-bis[(6-methyl-1H-benzimidazol-2-yl)methyl]methanamine (PubChem CID 25003992) has the molecular formula C32H35N7 and a molecular weight of 517.68 g/mol. Its IUPAC name is 1-[(3R)-2,7-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]-N,N-bis[(6-methyl-1H-benzimidazol-2-yl)methyl]methanamine.
| Compound Name | 1-[(3R)-2,7-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]-N,N-bis[(6-methyl-1H-benzimidazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 25003992 |
| Molecular Formula | C32H35N7 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | 1-[(3R)-2,7-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]-N,N-bis[(6-methyl-1H-benzimidazol-2-yl)methyl]methanamine |
| SMILES | Cc1ccc2nc(CN(Cc3nc4ccc(C)cc4[nH]3)C[C@H]3Cc4c([nH]c5cc(C)ccc45)CN3C)[nH]c2c1 |
| InChI | InChI=1S/C32H35N7/c1-19-5-8-23-24-14-22(38(4)16-30(24)33-27(23)11-19)15-39(17-31-34-25-9-6-20(2)12-28(25)36-31)18-32-35-26-10-7-21(3)13-29(26)37-32/h5-13,22,33H,14-18H2,1-4H3,(H,34,36)(H,35,37)/t22-/m1/s1 |
| InChIKey | PPFDIFQQCJGCFA-JOCHJYFZSA-N |
| XLogP | 5.90 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|