C21H24N2OS — CID 11394043
(1S)-2-[(R)-(4-methylphenyl)sulfinyl]-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11394043) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is (1S)-2-[(R)-(4-methylphenyl)sulfinyl]-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-2-[(R)-(4-methylphenyl)sulfinyl]-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11394043 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (1S)-2-[(R)-(4-methylphenyl)sulfinyl]-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Cc1ccc([S@@](=O)N2CCc3c([nH]c4ccccc34)[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C21H24N2OS/c1-14(2)21-20-18(17-6-4-5-7-19(17)22-20)12-13-23(21)25(24)16-10-8-15(3)9-11-16/h4-11,14,21-22H,12-13H2,1-3H3/t21-,25+/m0/s1 |
| InChIKey | HPSGWEDDJUIZKA-SQJMNOBHSA-N |
| XLogP | 4.75 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|