C26H34N2O3S — CID 102007144
1-(4,4-diethoxybutyl)-2-(4-methylphenyl)sulfinyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 102007144) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 1-(4,4-diethoxybutyl)-2-(4-methylphenyl)sulfinyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(4,4-diethoxybutyl)-2-(4-methylphenyl)sulfinyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 102007144 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-(4,4-diethoxybutyl)-2-(4-methylphenyl)sulfinyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCOC(CCCC1c2[nH]c3ccccc3c2CCN1S(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C26H34N2O3S/c1-4-30-25(31-5-2)12-8-11-24-26-22(21-9-6-7-10-23(21)27-26)17-18-28(24)32(29)20-15-13-19(3)14-16-20/h6-7,9-10,13-16,24-25,27H,4-5,8,11-12,17-18H2,1-3H3 |
| InChIKey | RGPFXOSNZMGCAG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|