C21H30N2O2 — CID 23244047
(1R,11R)-11-(4,4-diethoxybutyl)-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene (PubChem CID 23244047) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (1R,11R)-11-(4,4-diethoxybutyl)-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1R,11R)-11-(4,4-diethoxybutyl)-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 23244047 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (1R,11R)-11-(4,4-diethoxybutyl)-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
| SMILES | CCOC(CCC[C@@H]1c2[nH]c3ccccc3c2[C@H]2CCN1C2)OCC |
| InChI | InChI=1S/C21H30N2O2/c1-3-24-19(25-4-2)11-7-10-18-21-20(15-12-13-23(18)14-15)16-8-5-6-9-17(16)22-21/h5-6,8-9,15,18-19,22H,3-4,7,10-14H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | WUVJTNTYCSEVSG-MAUKXSAKSA-N |
| XLogP | 4.58 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|