C16H21N — CID 173176510
1-pentan-2-yl-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 173176510) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-pentan-2-yl-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | 1-pentan-2-yl-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 173176510 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1-pentan-2-yl-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | CCCC(C)C1CCc2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C16H21N/c1-3-6-11(2)12-9-10-15-16(12)13-7-4-5-8-14(13)17-15/h4-5,7-8,11-12,17H,3,6,9-10H2,1-2H3 |
| InChIKey | QAUXAUMGBQERQH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|