C14H15NO2 — CID 838888
(3R,4R)-4-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid (PubChem CID 838888) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (3R,4R)-4-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid.
| Compound Name | (3R,4R)-4-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 838888 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (3R,4R)-4-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid |
| SMILES | C[C@H]1c2c([nH]c3ccccc23)CC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H15NO2/c1-8-9(14(16)17)6-7-12-13(8)10-4-2-3-5-11(10)15-12/h2-5,8-9,15H,6-7H2,1H3,(H,16,17)/t8-,9-/m1/s1 |
| InChIKey | CLRAKOGNZHAAMR-RKDXNWHRSA-N |
| XLogP | 2.92 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|