C20H26N2 — CID 71235726
2-methyl-2-(4-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)cyclohex-3-en-1-amine (PubChem CID 71235726) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-methyl-2-(4-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)cyclohex-3-en-1-amine.
| Compound Name | 2-methyl-2-(4-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 71235726 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-methyl-2-(4-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)cyclohex-3-en-1-amine |
| SMILES | CC1c2c([nH]c3ccccc23)CCC1C1(C)C=CCCC1N |
| InChI | InChI=1S/C20H26N2/c1-13-15(20(2)12-6-5-9-18(20)21)10-11-17-19(13)14-7-3-4-8-16(14)22-17/h3-4,6-8,12-13,15,18,22H,5,9-11,21H2,1-2H3 |
| InChIKey | QLKSAOFYZPINDN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|