2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid

C12H12N2O2 — CID 12627214

IUPAC2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid
SMILESO=C(O)C1NCCc2[nH]c3ccccc3c21
InChIInChI=1S/C12H12N2O2/c15-12(16)11-10-7-3-1-2-4-8(7)14-9(10)5-6-13-11/h1-4,11,13-14H,5-6H2,(H,15,16)
InChIKeyLCCFBQOGARJSAX-UHFFFAOYSA-N
MW216.24 g/mol
LogP1.44
Rot. Bonds1

About 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid

2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid (PubChem CID 12627214) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid.

Molecular Properties

Compound Name2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid
PubChem CID12627214
Molecular FormulaC12H12N2O2
Molecular Weight216.24 g/mol
Exact Mass216.09
IUPAC Name2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid
SMILESO=C(O)C1NCCc2[nH]c3ccccc3c21
InChIInChI=1S/C12H12N2O2/c15-12(16)11-10-7-3-1-2-4-8(7)14-9(10)5-6-13-11/h1-4,11,13-14H,5-6H2,(H,15,16)
InChIKeyLCCFBQOGARJSAX-UHFFFAOYSA-N
XLogP1.44
TPSA65.12 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 51.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid?
The IUPAC name of 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid (CID 12627214) is 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid.
What is the SMILES notation for 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid?
The canonical SMILES for 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid is O=C(O)C1NCCc2[nH]c3ccccc3c21.
What is the InChIKey of 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid?
The InChIKey is LCCFBQOGARJSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c15-12(16)11-10-7-3-1-2-4-8(7)14-9(10)5-6-13-11/h1-4,11,13-14H,5-6H2,(H,15,16).
What are the key properties of 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid?
2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid has a molecular weight of 216.24 g/mol, XLogP of 1.44, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-1-carboxylic acid is sourced from PubChem (CID 12627214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).