C10H11ArNO2 — CID 160886017
argon;1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (PubChem CID 160886017) has the molecular formula C10H11ArNO2 and a molecular weight of 217.15 g/mol. Its IUPAC name is argon;1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid.
| Compound Name | argon;1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 160886017 |
| Molecular Formula | C10H11ArNO2 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | argon;1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| SMILES | O=C(O)C1NCCc2ccccc21.[Ar] |
| InChI | InChI=1S/C10H11NO2.Ar/c12-10(13)9-8-4-2-1-3-7(8)5-6-11-9;/h1-4,9,11H,5-6H2,(H,12,13); |
| InChIKey | SNQJMMRNAUXSBM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |