(1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid

C10H12N2O2 — CID 130632963

IUPAC(1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
SMILESNc1ccc2c(c1)[C@@H](C(=O)O)NCC2
InChIInChI=1S/C10H12N2O2/c11-7-2-1-6-3-4-12-9(10(13)14)8(6)5-7/h1-2,5,9,12H,3-4,11H2,(H,13,14)/t9-/m0/s1
InChIKeyMDAPGUHGGOWKOK-VIFPVBQESA-N
MW192.22 g/mol
LogP0.54
Rot. Bonds1

About (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid

(1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (PubChem CID 130632963) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid.

Molecular Properties

Compound Name(1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
PubChem CID130632963
Molecular FormulaC10H12N2O2
Molecular Weight192.22 g/mol
Exact Mass192.09
IUPAC Name(1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
SMILESNc1ccc2c(c1)[C@@H](C(=O)O)NCC2
InChIInChI=1S/C10H12N2O2/c11-7-2-1-6-3-4-12-9(10(13)14)8(6)5-7/h1-2,5,9,12H,3-4,11H2,(H,13,14)/t9-/m0/s1
InChIKeyMDAPGUHGGOWKOK-VIFPVBQESA-N
XLogP0.54
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.22
LogP ≤ 50.54
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid?
The IUPAC name of (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CID 130632963) is (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid.
What is the SMILES notation for (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid?
The canonical SMILES for (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid is Nc1ccc2c(c1)[C@@H](C(=O)O)NCC2.
What is the InChIKey of (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid?
The InChIKey is MDAPGUHGGOWKOK-VIFPVBQESA-N. The full InChI is InChI=1S/C10H12N2O2/c11-7-2-1-6-3-4-12-9(10(13)14)8(6)5-7/h1-2,5,9,12H,3-4,11H2,(H,13,14)/t9-/m0/s1.
What are the key properties of (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid?
(1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid has a molecular weight of 192.22 g/mol, XLogP of 0.54, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid is sourced from PubChem (CID 130632963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).