C11H14N2O2 — CID 139840356
methyl (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylate (PubChem CID 139840356) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylate.
| Compound Name | methyl (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 139840356 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | methyl (1S)-7-amino-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
| SMILES | COC(=O)[C@H]1NCCc2ccc(N)cc21 |
| InChI | InChI=1S/C11H14N2O2/c1-15-11(14)10-9-6-8(12)3-2-7(9)4-5-13-10/h2-3,6,10,13H,4-5,12H2,1H3/t10-/m0/s1 |
| InChIKey | XOJURYGNHZFLCB-JTQLQIEISA-N |
| XLogP | 0.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|