C11H10F3NO2 — CID 82579797
methyl 5,6,7-trifluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate (PubChem CID 82579797) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is methyl 5,6,7-trifluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate.
| Compound Name | methyl 5,6,7-trifluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 82579797 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | methyl 5,6,7-trifluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
| SMILES | COC(=O)C1NCCc2c1cc(F)c(F)c2F |
| InChI | InChI=1S/C11H10F3NO2/c1-17-11(16)10-6-4-7(12)9(14)8(13)5(6)2-3-15-10/h4,10,15H,2-3H2,1H3 |
| InChIKey | MPLDJROUUPIRBS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|