C11H14N2O2 — CID 99908919
methyl (3R)-6-amino-1,2,3,4-tetrahydroisoquinoline-3-carboxylate (PubChem CID 99908919) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl (3R)-6-amino-1,2,3,4-tetrahydroisoquinoline-3-carboxylate.
| Compound Name | methyl (3R)-6-amino-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 99908919 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | methyl (3R)-6-amino-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2cc(N)ccc2CN1 |
| InChI | InChI=1S/C11H14N2O2/c1-15-11(14)10-5-8-4-9(12)3-2-7(8)6-13-10/h2-4,10,13H,5-6,12H2,1H3/t10-/m1/s1 |
| InChIKey | XGLHSRWBNAKIEJ-SNVBAGLBSA-N |
| XLogP | 0.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|