C11H12INO3 — CID 139684443
methyl (3S)-7-hydroxy-8-iodo-1,2,3,4-tetrahydroisoquinoline-3-carboxylate (PubChem CID 139684443) has the molecular formula C11H12INO3 and a molecular weight of 333.13 g/mol. Its IUPAC name is methyl (3S)-7-hydroxy-8-iodo-1,2,3,4-tetrahydroisoquinoline-3-carboxylate.
| Compound Name | methyl (3S)-7-hydroxy-8-iodo-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 139684443 |
| Molecular Formula | C11H12INO3 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | methyl (3S)-7-hydroxy-8-iodo-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2ccc(O)c(I)c2CN1 |
| InChI | InChI=1S/C11H12INO3/c1-16-11(15)8-4-6-2-3-9(14)10(12)7(6)5-13-8/h2-3,8,13-14H,4-5H2,1H3/t8-/m0/s1 |
| InChIKey | JJSDAFAQDQEJFF-QMMMGPOBSA-N |
| XLogP | 1.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|