C8H13N3O2 — CID 86340649
methyl (6R)-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 86340649) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl (6R)-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | methyl (6R)-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 86340649 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | methyl (6R)-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | COC(=O)[C@H]1CC2=C(CN1)NCN2 |
| InChI | InChI=1S/C8H13N3O2/c1-13-8(12)6-2-5-7(3-9-6)11-4-10-5/h6,9-11H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | KETXTQTWVDCOKJ-ZCFIWIBFSA-N |
| XLogP | -1.12 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |