C18H17I2NO3 — CID 46872337
methyl (3S)-6,8-diiodo-7-phenylmethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate (PubChem CID 46872337) has the molecular formula C18H17I2NO3 and a molecular weight of 549.15 g/mol. Its IUPAC name is methyl (3S)-6,8-diiodo-7-phenylmethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate.
| Compound Name | methyl (3S)-6,8-diiodo-7-phenylmethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 46872337 |
| Molecular Formula | C18H17I2NO3 |
| Molecular Weight | 549.15 g/mol |
| Exact Mass | 548.93 |
| IUPAC Name | methyl (3S)-6,8-diiodo-7-phenylmethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc(I)c(OCc3ccccc3)c(I)c2CN1 |
| InChI | InChI=1S/C18H17I2NO3/c1-23-18(22)15-8-12-7-14(19)17(16(20)13(12)9-21-15)24-10-11-5-3-2-4-6-11/h2-7,15,21H,8-10H2,1H3/t15-/m0/s1 |
| InChIKey | MQZZDVQEBOBOBU-HNNXBMFYSA-N |
| XLogP | 3.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|