C18H17FINO3 — CID 134328120
(4-fluoro-6-iodo-5-phenylmethoxy-2,3-dihydro-1H-inden-1-yl)-methylcarbamic acid (PubChem CID 134328120) has the molecular formula C18H17FINO3 and a molecular weight of 441.24 g/mol. Its IUPAC name is (4-fluoro-6-iodo-5-phenylmethoxy-2,3-dihydro-1H-inden-1-yl)-methylcarbamic acid.
| Compound Name | (4-fluoro-6-iodo-5-phenylmethoxy-2,3-dihydro-1H-inden-1-yl)-methylcarbamic acid |
|---|---|
| PubChem CID | 134328120 |
| Molecular Formula | C18H17FINO3 |
| Molecular Weight | 441.24 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | (4-fluoro-6-iodo-5-phenylmethoxy-2,3-dihydro-1H-inden-1-yl)-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CCc2c1cc(I)c(OCc1ccccc1)c2F |
| InChI | InChI=1S/C18H17FINO3/c1-21(18(22)23)15-8-7-12-13(15)9-14(20)17(16(12)19)24-10-11-5-3-2-4-6-11/h2-6,9,15H,7-8,10H2,1H3,(H,22,23) |
| InChIKey | QTSDDGBFESWFSN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.24 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|