C16H14FIO — CID 175348033
4-fluoro-6-iodo-5-phenylmethoxy-2,3-dihydro-1H-indene (PubChem CID 175348033) has the molecular formula C16H14FIO and a molecular weight of 368.19 g/mol. Its IUPAC name is 4-fluoro-6-iodo-5-phenylmethoxy-2,3-dihydro-1H-indene.
| Compound Name | 4-fluoro-6-iodo-5-phenylmethoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 175348033 |
| Molecular Formula | C16H14FIO |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 4-fluoro-6-iodo-5-phenylmethoxy-2,3-dihydro-1H-indene |
| SMILES | Fc1c2c(cc(I)c1OCc1ccccc1)CCC2 |
| InChI | InChI=1S/C16H14FIO/c17-15-13-8-4-7-12(13)9-14(18)16(15)19-10-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2 |
| InChIKey | CWJUWIYQIOUZGY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|