C26H27IO2 — CID 23031219
7-iodo-5-methyl-4-(4-phenylmethoxy-3-propan-2-ylphenoxy)-2,3-dihydro-1H-indene (PubChem CID 23031219) has the molecular formula C26H27IO2 and a molecular weight of 498.40 g/mol. Its IUPAC name is 7-iodo-5-methyl-4-(4-phenylmethoxy-3-propan-2-ylphenoxy)-2,3-dihydro-1H-indene.
| Compound Name | 7-iodo-5-methyl-4-(4-phenylmethoxy-3-propan-2-ylphenoxy)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 23031219 |
| Molecular Formula | C26H27IO2 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 7-iodo-5-methyl-4-(4-phenylmethoxy-3-propan-2-ylphenoxy)-2,3-dihydro-1H-indene |
| SMILES | Cc1cc(I)c2c(c1Oc1ccc(OCc3ccccc3)c(C(C)C)c1)CCC2 |
| InChI | InChI=1S/C26H27IO2/c1-17(2)23-15-20(12-13-25(23)28-16-19-8-5-4-6-9-19)29-26-18(3)14-24(27)21-10-7-11-22(21)26/h4-6,8-9,12-15,17H,7,10-11,16H2,1-3H3 |
| InChIKey | GXMGQQCCBXCYEY-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|