C15H9F6IO — CID 90300169
1-iodo-2-phenylmethoxy-3,5-bis(trifluoromethyl)benzene (PubChem CID 90300169) has the molecular formula C15H9F6IO and a molecular weight of 446.13 g/mol. Its IUPAC name is 1-iodo-2-phenylmethoxy-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-iodo-2-phenylmethoxy-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 90300169 |
| Molecular Formula | C15H9F6IO |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 445.96 |
| IUPAC Name | 1-iodo-2-phenylmethoxy-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(I)c(OCc2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F6IO/c16-14(17,18)10-6-11(15(19,20)21)13(12(22)7-10)23-8-9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | IPNMBWPTTGGQJM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|