C23H16F6O3 — CID 86668560
4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-phenylmethoxybenzaldehyde (PubChem CID 86668560) has the molecular formula C23H16F6O3 and a molecular weight of 454.37 g/mol. Its IUPAC name is 4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-phenylmethoxybenzaldehyde.
| Compound Name | 4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 86668560 |
| Molecular Formula | C23H16F6O3 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-phenylmethoxybenzaldehyde |
| SMILES | O=Cc1ccc(OCc2ccc(C(F)(F)F)cc2C(F)(F)F)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H16F6O3/c24-22(25,26)18-8-7-17(19(11-18)23(27,28)29)14-32-20-9-6-16(12-30)10-21(20)31-13-15-4-2-1-3-5-15/h1-12H,13-14H2 |
| InChIKey | JLHGUWNCNCRTAT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|