C17H9F9O3 — CID 122476736
3-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-5-(trifluoromethoxy)benzaldehyde (PubChem CID 122476736) has the molecular formula C17H9F9O3 and a molecular weight of 432.24 g/mol. Its IUPAC name is 3-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-5-(trifluoromethoxy)benzaldehyde.
| Compound Name | 3-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-5-(trifluoromethoxy)benzaldehyde |
|---|---|
| PubChem CID | 122476736 |
| Molecular Formula | C17H9F9O3 |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 3-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-5-(trifluoromethoxy)benzaldehyde |
| SMILES | O=Cc1cc(OCc2ccc(C(F)(F)F)cc2C(F)(F)F)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F9O3/c18-15(19,20)11-2-1-10(14(5-11)16(21,22)23)8-28-12-3-9(7-27)4-13(6-12)29-17(24,25)26/h1-7H,8H2 |
| InChIKey | NZIALKZARRXFLJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|