C15H9Cl2F3O2 — CID 122475914
3-[(2,6-dichlorophenyl)methoxy]-5-(trifluoromethyl)benzaldehyde (PubChem CID 122475914) has the molecular formula C15H9Cl2F3O2 and a molecular weight of 349.14 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methoxy]-5-(trifluoromethyl)benzaldehyde.
| Compound Name | 3-[(2,6-dichlorophenyl)methoxy]-5-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 122475914 |
| Molecular Formula | C15H9Cl2F3O2 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methoxy]-5-(trifluoromethyl)benzaldehyde |
| SMILES | O=Cc1cc(OCc2c(Cl)cccc2Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9Cl2F3O2/c16-13-2-1-3-14(17)12(13)8-22-11-5-9(7-21)4-10(6-11)15(18,19)20/h1-7H,8H2 |
| InChIKey | SBMLFSMBKYQCIC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|