About 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene
2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene (PubChem CID 2807423) has the molecular formula C15H8Cl2F6O2S
and a molecular weight of 437.19 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene.
Molecular Properties
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene |
| PubChem CID | 2807423 |
| Molecular Formula | C15H8Cl2F6O2S |
| Molecular Weight | 437.19 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene |
| SMILES | O=S(=O)(Cc1c(Cl)cccc1Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8Cl2F6O2S/c16-12-2-1-3-13(17)11(12)7-26(24,25)10-5-8(14(18,19)20)4-9(6-10)15(21,22)23/h1-6H,7H2 |
| InChIKey | SVFYMBLRMZBBCP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.19 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene?
The IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene (CID 2807423) is 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene.
What is the SMILES notation for 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene?
The canonical SMILES for 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene is O=S(=O)(Cc1c(Cl)cccc1Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene?
The InChIKey is SVFYMBLRMZBBCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl2F6O2S/c16-12-2-1-3-13(17)11(12)7-26(24,25)10-5-8(14(18,19)20)4-9(6-10)15(21,22)23/h1-6H,7H2.
What are the key properties of 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene?
2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene has a molecular weight of 437.19 g/mol, XLogP of 6.00, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylmethyl]-1,3-dichlorobenzene is sourced from PubChem (CID 2807423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).