C18H11F9O3 — CID 122475998
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2,2,2-trifluoroethoxy)benzaldehyde (PubChem CID 122475998) has the molecular formula C18H11F9O3 and a molecular weight of 446.27 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2,2,2-trifluoroethoxy)benzaldehyde.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2,2,2-trifluoroethoxy)benzaldehyde |
|---|---|
| PubChem CID | 122475998 |
| Molecular Formula | C18H11F9O3 |
| Molecular Weight | 446.27 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2,2,2-trifluoroethoxy)benzaldehyde |
| SMILES | O=Cc1cc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H11F9O3/c19-16(20,21)9-30-15-4-10(7-28)3-14(6-15)29-8-11-1-12(17(22,23)24)5-13(2-11)18(25,26)27/h1-7H,8-9H2 |
| InChIKey | ARQOEPNRPGKCJP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.27 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|