C18H13F6NO2 — CID 174426822
5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydro-1H-isoindole-1-carbaldehyde (PubChem CID 174426822) has the molecular formula C18H13F6NO2 and a molecular weight of 389.30 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydro-1H-isoindole-1-carbaldehyde.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydro-1H-isoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174426822 |
| Molecular Formula | C18H13F6NO2 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydro-1H-isoindole-1-carbaldehyde |
| SMILES | O=CC1NCc2cc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C18H13F6NO2/c19-17(20,21)12-3-10(4-13(6-12)18(22,23)24)9-27-14-1-2-15-11(5-14)7-25-16(15)8-26/h1-6,8,16,25H,7,9H2 |
| InChIKey | RFVIWOGNHDMVEY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|