C17H12F6O — CID 122475861
3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde (PubChem CID 122475861) has the molecular formula C17H12F6O and a molecular weight of 346.27 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde |
|---|---|
| PubChem CID | 122475861 |
| Molecular Formula | C17H12F6O |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde |
| SMILES | Cc1cc(C=O)cc(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H12F6O/c1-10-2-11(5-13(3-10)9-24)4-12-6-14(16(18,19)20)8-15(7-12)17(21,22)23/h2-3,5-9H,4H2,1H3 |
| InChIKey | PBRAOHBSXUUXCE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|