C23H23BO4 — CID 159498877
3-benzyl-5-methylbenzaldehyde;(3-formyl-5-methylphenyl)boronic acid (PubChem CID 159498877) has the molecular formula C23H23BO4 and a molecular weight of 374.25 g/mol. Its IUPAC name is 3-benzyl-5-methylbenzaldehyde;(3-formyl-5-methylphenyl)boronic acid.
| Compound Name | 3-benzyl-5-methylbenzaldehyde;(3-formyl-5-methylphenyl)boronic acid |
|---|---|
| PubChem CID | 159498877 |
| Molecular Formula | C23H23BO4 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-benzyl-5-methylbenzaldehyde;(3-formyl-5-methylphenyl)boronic acid |
| SMILES | Cc1cc(C=O)cc(B(O)O)c1.Cc1cc(C=O)cc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C15H14O.C8H9BO3/c1-12-7-14(10-15(8-12)11-16)9-13-5-3-2-4-6-13;1-6-2-7(5-10)4-8(3-6)9(11)12/h2-8,10-11H,9H2,1H3;2-5,11-12H,1H3 |
| InChIKey | LZDAXHFNHVZKHR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|