About 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde
3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde (PubChem CID 122475736) has the molecular formula C17H12F6O
and a molecular weight of 346.27 g/mol. Its IUPAC name is 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde.
Molecular Properties
| Compound Name | 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde |
| PubChem CID | 122475736 |
| Molecular Formula | C17H12F6O |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde |
| SMILES | Cc1cc(C=O)cc(Cc2cc(C(F)(F)F)ccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F6O/c1-10-4-11(6-12(5-10)9-24)7-13-8-14(16(18,19)20)2-3-15(13)17(21,22)23/h2-6,8-9H,7H2,1H3 |
| InChIKey | PPMWFJKEAJWRSC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde?
The IUPAC name of 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde (CID 122475736) is 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde.
What is the SMILES notation for 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde?
The canonical SMILES for 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde is Cc1cc(C=O)cc(Cc2cc(C(F)(F)F)ccc2C(F)(F)F)c1.
What is the InChIKey of 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde?
The InChIKey is PPMWFJKEAJWRSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F6O/c1-10-4-11(6-12(5-10)9-24)7-13-8-14(16(18,19)20)2-3-15(13)17(21,22)23/h2-6,8-9H,7H2,1H3.
What are the key properties of 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde?
3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde has a molecular weight of 346.27 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-methylbenzaldehyde is sourced from PubChem (CID 122475736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).