C10H8F6O2S — CID 158352048
1-methyl-3-(trifluoromethyl)-5-(trifluoromethylsulfonylmethyl)benzene (PubChem CID 158352048) has the molecular formula C10H8F6O2S and a molecular weight of 306.23 g/mol. Its IUPAC name is 1-methyl-3-(trifluoromethyl)-5-(trifluoromethylsulfonylmethyl)benzene.
| Compound Name | 1-methyl-3-(trifluoromethyl)-5-(trifluoromethylsulfonylmethyl)benzene |
|---|---|
| PubChem CID | 158352048 |
| Molecular Formula | C10H8F6O2S |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 1-methyl-3-(trifluoromethyl)-5-(trifluoromethylsulfonylmethyl)benzene |
| SMILES | Cc1cc(CS(=O)(=O)C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F6O2S/c1-6-2-7(4-8(3-6)9(11,12)13)5-19(17,18)10(14,15)16/h2-4H,5H2,1H3 |
| InChIKey | UNHMYKBBCQVVTK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |