C9H6F6NO2S- — CID 152764715
[3,5-bis(trifluoromethyl)phenyl]methylsulfonylazanide (PubChem CID 152764715) has the molecular formula C9H6F6NO2S- and a molecular weight of 306.21 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methylsulfonylazanide.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methylsulfonylazanide |
|---|---|
| PubChem CID | 152764715 |
| Molecular Formula | C9H6F6NO2S- |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methylsulfonylazanide |
| SMILES | [NH-]S(=O)(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F6NO2S/c10-8(11,12)6-1-5(4-19(16,17)18)2-7(3-6)9(13,14)15/h1-3H,4H2,(H-,16,17,18)/q-1 |
| InChIKey | ZPIOQZXXGCQZGX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |