C8H4F6LiN — CID 132500492
lithium [3,5-bis(trifluoromethyl)phenyl]azanide (PubChem CID 132500492) has the molecular formula C8H4F6LiN and a molecular weight of 235.06 g/mol. Its IUPAC name is lithium [3,5-bis(trifluoromethyl)phenyl]azanide.
| Compound Name | lithium [3,5-bis(trifluoromethyl)phenyl]azanide |
|---|---|
| PubChem CID | 132500492 |
| Molecular Formula | C8H4F6LiN |
| Molecular Weight | 235.06 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | lithium [3,5-bis(trifluoromethyl)phenyl]azanide |
| SMILES | [Li+].[NH-]c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4F6N.Li/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4;/h1-3,15H;/q-1;+1 |
| InChIKey | YLFYOSLWSKYWEW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.06 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |