C11H12F6Sn — CID 14523014
[3,5-bis(trifluoromethyl)phenyl]-trimethylstannane (PubChem CID 14523014) has the molecular formula C11H12F6Sn and a molecular weight of 376.92 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-trimethylstannane.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-trimethylstannane |
|---|---|
| PubChem CID | 14523014 |
| Molecular Formula | C11H12F6Sn |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-trimethylstannane |
| SMILES | C[Sn](C)(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H3F6.3CH3.Sn/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14;;;;/h2-4H;3*1H3; |
| InChIKey | NVPVEEOKTSYTDO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |